Showing entry for alpha-L-Sorbopyranose
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031390 |
| Compound Name | alpha-L-Sorbopyranose |
| Structure | ![]() |
| Formula | C6H12O6 |
| InchiKey | LKDRXBCSQODPBY-BGPJRJDNSA-N |
| SMILES | OC[C@@]1(O)OC[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4+,5-,6+/m0/s1 |
| IUPAC | (2R,3S,4R,5S)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| Molecular Weight | 180.06 |
| Pubchem Id | 441484 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | SOE |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
