Showing entry for 2-Hydroxy-3-methoxy-7,8-methylenedioxy-4,9-dioxapyrene-5,10-dione
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031616 |
| Compound Name | 2-Hydroxy-3-methoxy-7,8-methylenedioxy-4,9-dioxapyrene-5,10-dione |
| Structure | ![]() |
| Formula | C16H8O8 |
| InchiKey | MKSFEZKHACTMCV-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc2c3c1oc(=O)c1c3c(oc2=O)c2c(c1)OCO2 |
| Inchi | InChI=1S/C16H8O8/c1-20-11-7(17)2-5-9-10-6(16(19)23-13(9)11)3-8-12(22-4-21-8)14(10)24-15(5)18/h2-3,17H,4H2,1H3 |
| IUPAC | |
| Molecular Weight | 328.02 |
| Pubchem Id | 10336592 |
| Chembl Id | CHEMBL4247374 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4247374 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
