Showing entry for Angustone B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031641 |
| Compound Name | Angustone B |
| Structure | ![]() |
| Formula | C25H24O6 |
| InchiKey | QQUXNFZAFOMGTQ-UHFFFAOYSA-N |
| SMILES | CC(=CCc1c(O)cc2c(c1O)c(=O)c(co2)c1ccc2c(c1O)C=CC(O2)(C)C)C |
| Inchi | InChI=1S/C25H24O6/c1-13(2)5-6-15-18(26)11-20-21(23(15)28)24(29)17(12-30-20)14-7-8-19-16(22(14)27)9-10-25(3,4)31-19/h5,7-12,26-28H,6H2,1-4H3 |
| IUPAC | 5,7-dihydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)-6-(3-methylbut-2-enyl)chromen-4-one |
| Molecular Weight | 420.16 |
| Pubchem Id | 5481235 |
| Chembl Id | CHEMBL4064421 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4064421 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
