Showing entry for Alstonine hydrochloride
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031698 |
| Compound Name | Alstonine hydrochloride |
| Structure | ![]() |
| Formula | C21H20N2O3.ClH |
| InchiKey | HKPNHORYVYLABA-VMESOOAKSA-N |
| SMILES | COC(=O)C1=CO[C@H]([C@H]2[C@@H]1Cc1n(C2)ccc2c1nc1c2cccc1)C.Cl |
| Inchi | InChI=1S/C21H20N2O3.ClH/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2;/h3-8,11-12,15-16H,9-10H2,1-2H3;1H/t12-,15-,16-;/m0./s1 |
| IUPAC | |
| Molecular Weight | 348.15 |
| Pubchem Id | 5351597 |
| Chembl Id | CHEMBL502838 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL502838 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
