Showing entry for Nandinine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031707 |
| Compound Name | Nandinine |
| Structure | ![]() |
| Formula | C19H19NO4 |
| InchiKey | PQECCKIOFCWGRJ-HNNXBMFYSA-N |
| SMILES | COc1ccc2c(c1O)CN1[C@@H](C2)c2cc3OCOc3cc2CC1 |
| Inchi | InChI=1S/C19H19NO4/c1-22-16-3-2-11-6-15-13-8-18-17(23-10-24-18)7-12(13)4-5-20(15)9-14(11)19(16)21/h2-3,7-8,15,21H,4-6,9-10H2,1H3/t15-/m0/s1 |
| IUPAC | |
| Molecular Weight | 325.13 |
| Pubchem Id | 12313091 |
| Chembl Id | CHEMBL2314732 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50424073 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2314732 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
