Showing entry for 2',5'-DIHYDROXYACETOPHENONE
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031899 |
| Compound Name | 2',5'-DIHYDROXYACETOPHENONE |
| Structure | ![]() |
| Formula | C8H8O3 |
| InchiKey | WLDWSGZHNBANIO-UHFFFAOYSA-N |
| SMILES | Oc1ccc(c(c1)C(=O)C)O |
| Inchi | InChI=1S/C8H8O3/c1-5(9)7-4-6(10)2-3-8(7)11/h2-4,10-11H,1H3 |
| IUPAC | 1-(2,5-dihydroxyphenyl)ethanone |
| Molecular Weight | 152.05 |
| Pubchem Id | 10279 |
| Chembl Id | CHEMBL2348532 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2348532 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
