Showing entry for neotanshinlactone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0032189 |
| Compound Name | neotanshinlactone |
| Structure | ![]() |
| Formula | C17H12O3 |
| InchiKey | LGZUUBFLEYOEEX-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c1ccc1c2oc(=O)c2c1occ2C |
| Inchi | InChI=1S/C17H12O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)20-17(18)14-10(2)8-19-16(13)14/h3-8H,1-2H3 |
| IUPAC | |
| Molecular Weight | 264.08 |
| Pubchem Id | 10264769 |
| Chembl Id | CHEMBL364132 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL364132 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
