Showing entry for toosendanin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0032194 |
| Compound Name | toosendanin |
| Structure | ![]() |
| Formula | C30H38O11 |
| InchiKey | NAHTXVIXCMUDLF-RFNFAWMESA-N |
| SMILES | CC(=O)O[C@H]1C(=O)[C@@H]2[C@@]34CO[C@H]([C@]([C@@H]4C[C@H]([C@]2([C@@]24[C@]1(C)[C@@H](C[C@H]4O2)c1ccoc1)C)O)([C@@H](C[C@@H]3O)OC(=O)C)C)O |
| Inchi | InChI=1S/C30H38O11/c1-13(31)39-20-10-19(34)29-12-38-25(36)26(20,3)17(29)9-18(33)28(5)23(29)22(35)24(40-14(2)32)27(4)16(15-6-7-37-11-15)8-21-30(27,28)41-21/h6-7,11,16-21,23-25,33-34,36H,8-10,12H2,1-5H3/t16-,17-,18+,19-,20+,21+,23-,24-,25+,26+,27+,28+,29+,3 |
| IUPAC | |
| Molecular Weight | 574.24 |
| Pubchem Id | 9851101 |
| Chembl Id | CHEMBL503044 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL503044 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
