Showing entry for N-Formylcytisine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0032455 |
| Compound Name | N-Formylcytisine |
| Structure | ![]() |
| Formula | C12H14N2O2 |
| InchiKey | PCYQRXYBKKZUSR-UHFFFAOYSA-N |
| SMILES | O=CN1CC2CC(C1)c1n(C2)c(=O)ccc1 |
| Inchi | InChI=1S/C12H14N2O2/c15-8-13-5-9-4-10(7-13)11-2-1-3-12(16)14(11)6-9/h1-3,8-10H,4-7H2 |
| IUPAC | |
| Molecular Weight | 218.11 |
| Pubchem Id | 589870 |
| Chembl Id | CHEMBL1433686 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1433686 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
