Showing entry for Chlorophyll A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0032704 |
| Compound Name | Chlorophyll A |
| Structure | ![]() |
| Formula | C55H73N4O5.Mg |
| InchiKey | ATNHDLDRLWWWCB-AENOIHSZSA-M |
| SMILES | COC(=O)[C@H]1C(=O)C2=C(C)C3=Cc4[n-]c(c(c4CC)C)C=c4[nH]c(=CC5=NC(=C1C2=N3)[C@@H](CCC(=O)OC/C=C(/CCC[C@@H](CCC[C@@H](CCCC(C)C)C)C)\C)[C@@H]5C)c(C)c4C=C.[Mg+2] |
| Inchi | InChI=1S/C55H73N4O5.Mg/c1-13-39-35(8)42-28-44-37(10)41(24-25-48(60)64-27-26-34(7)23-17-22-33(6)21-16-20-32(5)19-15-18-31(3)4)52(58-44)50-51(55(62)63-12)54(61)49-38(11)45(59-53(49)50)30-47-40(14-2)36(9)43(57-47)29-46(39)56-42;/h13,26,28-33,37,41,51H,1,14-2 |
| IUPAC | |
| Molecular Weight | 893.54 |
| Pubchem Id | 12085802 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||
| DrugBank | DB02133 |
|
||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
