Showing entry for Bisnorstriatol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0032709 |
| Compound Name | Bisnorstriatol |
| Structure | ![]() |
| Formula | C26H38O4 |
| InchiKey | QUXULJDSRDXUCR-UHFFFAOYSA-N |
| SMILES | Oc1cc(CCCCCCCCCCCCCCc2cc(O)cc(c2)O)cc(c1)O |
| Inchi | InChI=1S/C26H38O4/c27-23-15-21(16-24(28)19-23)13-11-9-7-5-3-1-2-4-6-8-10-12-14-22-17-25(29)20-26(30)18-22/h15-20,27-30H,1-14H2 |
| IUPAC | 5-[14-(3,5-dihydroxyphenyl)tetradecyl]benzene-1,3-diol |
| Molecular Weight | 414.28 |
| Pubchem Id | 10431955 |
| Chembl Id | CHEMBL426392 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50203241 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL426392 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
