Showing entry for Crocusatin H
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0032762 |
| Compound Name | Crocusatin H |
| Structure | ![]() |
| Formula | C12H20O4 |
| InchiKey | FSOYBCXXCQPHMB-IUCAKERBSA-N |
| SMILES | O[C@H]1CC(=C(C(C1)(C)C)[C@H](CC(=O)O)O)C |
| Inchi | InChI=1S/C12H20O4/c1-7-4-8(13)6-12(2,3)11(7)9(14)5-10(15)16/h8-9,13-14H,4-6H2,1-3H3,(H,15,16)/t8-,9-/m0/s1 |
| IUPAC | (3S)-3-hydroxy-3-[(4S)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]propanoic acid |
| Molecular Weight | 228.14 |
| Pubchem Id | 637013 |
| Chembl Id | CHEMBL451014 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50260194 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL451014 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
