Showing entry for sarpagine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0033125 |
| Compound Name | sarpagine |
| Structure | ![]() |
| Formula | C19H22N2O2 |
| InchiKey | VTVQHYQGTTVKDE-QDHOPYFXSA-N |
| SMILES | OC[C@H]1[C@@H]2Cc3c([C@H]4N2C/C(=C/C)/[C@H]1C4)[nH]c1c3cc(O)cc1 |
| Inchi | InChI=1S/C19H22N2O2/c1-2-10-8-21-17-7-14-13-5-11(23)3-4-16(13)20-19(14)18(21)6-12(10)15(17)9-22/h2-5,12,15,17-18,20,22-23H,6-9H2,1H3/b10-2-/t12-,15-,17+,18+/m1/s1 |
| IUPAC | |
| Molecular Weight | 310.17 |
| Pubchem Id | 44592554 |
| Chembl Id | CHEMBL498733 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL498733 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
