Showing entry for (2E,4E)-1-Isopentylamino-5-(1,3-benzodioxole-5-yl)-2,4-pentadiene-1-one
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0033458 |
| Compound Name | (2E,4E)-1-Isopentylamino-5-(1,3-benzodioxole-5-yl)-2,4-pentadiene-1-one |
| Structure | ![]() |
| Formula | C17H21NO3 |
| InchiKey | USDFAFZPUOHPKV-GGWOSOGESA-N |
| SMILES | CC(CCN=C(/C=C/C=C/c1ccc2c(c1)OCO2)O)C |
| Inchi | InChI=1S/C17H21NO3/c1-13(2)9-10-18-17(19)6-4-3-5-14-7-8-15-16(11-14)21-12-20-15/h3-8,11,13H,9-10,12H2,1-2H3,(H,18,19)/b5-3+,6-4+ |
| IUPAC | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(3-methylbutyl)penta-2,4-dienamide |
| Molecular Weight | 287.15 |
| Pubchem Id | 45482110 |
| Chembl Id | CHEMBL574063 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL574063 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
