Showing entry for pretazettine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0033662 |
| Compound Name | pretazettine |
| Structure | ![]() |
| Formula | C18H21NO5 |
| InchiKey | KLJOYDMUWKSYBP-WXNLUCNWSA-N |
| SMILES | CO[C@@H]1C=C[C@]23[C@H](C1)N(C)C[C@@H]2OC(c1c3cc2OCOc2c1)O |
| Inchi | InChI=1S/C18H21NO5/c1-19-8-16-18(4-3-10(21-2)5-15(18)19)12-7-14-13(22-9-23-14)6-11(12)17(20)24-16/h3-4,6-7,10,15-17,20H,5,8-9H2,1-2H3/t10-,15+,16+,17?,18+/m1/s1 |
| IUPAC | |
| Molecular Weight | 331.14 |
| Pubchem Id | 10314625 |
| Chembl Id | CHEMBL606758 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL606758 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
