Showing entry for Antimycin A2a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0033832 |
| Compound Name | Antimycin A2a |
| Structure | ![]() |
| Formula | C27H38N2O9 |
| InchiKey | KHLDVDGEVBRYTL-JABWOZRQSA-N |
| SMILES | CCCCCC[C@H]1C(=O)O[C@H](C)[C@@H](C(=O)O[C@H]([C@@H]1OC(=O)C(C)C)C)N=C(c1cccc(c1O)N=CO)O |
| Inchi | InChI=1S/C27H38N2O9/c1-6-7-8-9-11-19-23(38-25(33)15(2)3)17(5)37-27(35)21(16(4)36-26(19)34)29-24(32)18-12-10-13-20(22(18)31)28-14-30/h10,12-17,19,21,23,31H,6-9,11H2,1-5H3,(H,28,30)(H,29,32)/t16-,17+,19-,21+,23+/m1/s1 |
| IUPAC | [(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| Molecular Weight | 534.26 |
| Pubchem Id | 447434 |
| Chembl Id | CHEMBL4287406 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||
| PDB | AY1 |
|
|||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4287406 |
|
|||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
