Showing entry for 3'-O-methylorobol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0033923 |
| Compound Name | 3'-O-methylorobol |
| Structure | ![]() |
| Formula | C16H12O6 |
| InchiKey | ZMFBGWWGXBNJAC-UHFFFAOYSA-N |
| SMILES | COc1cc(ccc1O)c1coc2c(c1=O)c(O)cc(c2)O |
| Inchi | InChI=1S/C16H12O6/c1-21-13-4-8(2-3-11(13)18)10-7-22-14-6-9(17)5-12(19)15(14)16(10)20/h2-7,17-19H,1H3 |
| IUPAC | 5,7-dihydroxy-3-(4-hydroxy-3-methoxyphenyl)chromen-4-one |
| Molecular Weight | 300.06 |
| Pubchem Id | 5319744 |
| Chembl Id | CHEMBL241402 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50114972 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL241402 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
