Showing entry for Datiscetin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034102 |
| Compound Name | Datiscetin |
| Structure | ![]() |
| Formula | C15H10O6 |
| InchiKey | WCNLFPKXBGWWDS-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)c2c(c1)oc(c(c2=O)O)c1ccccc1O |
| Inchi | InChI=1S/C15H10O6/c16-7-5-10(18)12-11(6-7)21-15(14(20)13(12)19)8-3-1-2-4-9(8)17/h1-6,16-18,20H |
| IUPAC | 3,5,7-trihydroxy-2-(2-hydroxyphenyl)chromen-4-one |
| Molecular Weight | 286.05 |
| Pubchem Id | 5281610 |
| Chembl Id | CHEMBL503168 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | CC6 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 153270 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL503168 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
