Showing entry for Marchantin B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034145 |
| Compound Name | Marchantin B |
| Structure | ![]() |
| Formula | C28H24O6 |
| InchiKey | NCHXANMHUQGJGW-UHFFFAOYSA-N |
| SMILES | Oc1c(O)ccc2c1Oc1cccc(c1)CCc1cc(O)c(c(c1)Oc1ccc(CC2)cc1)O |
| Inchi | InChI=1S/C28H24O6/c29-23-13-10-20-9-6-17-7-11-21(12-8-17)33-25-16-19(15-24(30)26(25)31)5-4-18-2-1-3-22(14-18)34-28(20)27(23)32/h1-3,7-8,10-16,29-32H,4-6,9H2 |
| IUPAC | |
| Molecular Weight | 456.16 |
| Pubchem Id | 5319271 |
| Chembl Id | CHEMBL2040593 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2040593 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
