Showing entry for (Rac)-Abyssinone Ii
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034238 |
| Compound Name | (Rac)-Abyssinone Ii |
| Structure | ![]() |
| Formula | C20H20O4 |
| InchiKey | NLTOTZSPOYWSSP-UHFFFAOYSA-N |
| SMILES | CC(=CCc1cc(ccc1O)C1CC(=O)c2c(O1)cc(cc2)O)C |
| Inchi | InChI=1S/C20H20O4/c1-12(2)3-4-13-9-14(5-8-17(13)22)19-11-18(23)16-7-6-15(21)10-20(16)24-19/h3,5-10,19,21-22H,4,11H2,1-2H3 |
| IUPAC | 7-hydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-2,3-dihydrochromen-4-one |
| Molecular Weight | 324.14 |
| Pubchem Id | 10064832 |
| Chembl Id | CHEMBL389924 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50213251 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL389924 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
