Showing entry for 4-[(3R,5S)-3,5-Dihydroxy-7-(4-Hydroxyphenyl)Heptyl]Benzene-1,2-Diol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034281 |
| Compound Name | 4-[(3R,5S)-3,5-Dihydroxy-7-(4-Hydroxyphenyl)Heptyl]Benzene-1,2-Diol |
| Structure | ![]() |
| Formula | C19H24O5 |
| InchiKey | XLTITIJKWVRJMS-DLBZAZTESA-N |
| SMILES | O[C@H](C[C@@H](CCc1ccc(c(c1)O)O)O)CCc1ccc(cc1)O |
| Inchi | InChI=1S/C19H24O5/c20-15-6-1-13(2-7-15)3-8-16(21)12-17(22)9-4-14-5-10-18(23)19(24)11-14/h1-2,5-7,10-11,16-17,20-24H,3-4,8-9,12H2/t16-,17+/m0/s1 |
| IUPAC | 4-[(3R,5S)-3,5-dihydroxy-7-(4-hydroxyphenyl)heptyl]benzene-1,2-diol |
| Molecular Weight | 332.16 |
| Pubchem Id | 53387510 |
| Chembl Id | CHEMBL1824567 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1824567 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
