Showing entry for Schisandrene
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034408 |
| Compound Name | Schisandrene |
| Structure | ![]() |
| Formula | C29H26O8 |
| InchiKey | VBNGAFROWJLPCL-MYYSRTQBSA-N |
| SMILES | COc1c2OCOc2cc2c1c1c(C[C@H](C(=C)[C@@H]2OC(=O)c2ccccc2)C)cc2c(c1OC)OCO2 |
| Inchi | InChI=1S/C29H26O8/c1-15-10-18-11-20-25(35-13-33-20)27(31-3)22(18)23-19(12-21-26(28(23)32-4)36-14-34-21)24(16(15)2)37-29(30)17-8-6-5-7-9-17/h5-9,11-12,15,24H,2,10,13-14H2,1,3-4H3/t15-,24+/m1/s1 |
| IUPAC | |
| Molecular Weight | 502.16 |
| Pubchem Id | 11613047 |
| Chembl Id | CHEMBL479899 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL479899 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
