Showing entry for 7,4'-Dihydroxyflavan
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034493 |
| Compound Name | 7,4'-Dihydroxyflavan |
| Structure | ![]() |
| Formula | C15H14O3 |
| InchiKey | YXMLGIGHGPSEKA-AWEZNQCLSA-N |
| SMILES | Oc1ccc(cc1)[C@@H]1CCc2c(O1)cc(cc2)O |
| Inchi | InChI=1S/C15H14O3/c16-12-5-1-10(2-6-12)14-8-4-11-3-7-13(17)9-15(11)18-14/h1-3,5-7,9,14,16-17H,4,8H2/t14-/m0/s1 |
| IUPAC | (2S)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| Molecular Weight | 242.09 |
| Pubchem Id | 158280 |
| Chembl Id | CHEMBL463168 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL463168 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
