Showing entry for Cyclobuxophylline K
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034527 |
| Compound Name | Cyclobuxophylline K |
| Structure | ![]() |
| Formula | C26H41NO |
| InchiKey | HHRXHLXZXPRKOE-WSYJSIOHSA-N |
| SMILES | C/C=C\1/C(=O)C[C@@]2([C@]1(C)CC[C@@]13[C@H]2CC[C@@H]2[C@]3(C1)CC[C@@H](C2(C)C)N(C)C)C |
| Inchi | InChI=1S/C26H41NO/c1-8-17-18(28)15-24(5)20-10-9-19-22(2,3)21(27(6)7)11-12-25(19)16-26(20,25)14-13-23(17,24)4/h8,19-21H,9-16H2,1-7H3/b17-8-/t19-,20-,21-,23+,24-,25+,26-/m0/s1 |
| IUPAC | |
| Molecular Weight | 383.32 |
| Pubchem Id | 50908834 |
| Chembl Id | CHEMBL1651048 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1651048 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
