Showing entry for norwogonin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034597 |
| Compound Name | norwogonin |
| Structure | ![]() |
| Formula | C15H10O5 |
| InchiKey | ZFKKRRMUPBBYRS-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)c2c(c1O)oc(cc2=O)c1ccccc1 |
| Inchi | InChI=1S/C15H10O5/c16-9-6-11(18)14(19)15-13(9)10(17)7-12(20-15)8-4-2-1-3-5-8/h1-7,16,18-19H |
| IUPAC | 5,7,8-trihydroxy-2-phenylchromen-4-one |
| Molecular Weight | 270.05 |
| Pubchem Id | 5281674 |
| Chembl Id | CHEMBL485250 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL485250 |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
