Showing entry for 7-O-Methylluteone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034717 |
| Compound Name | 7-O-Methylluteone |
| Structure | ![]() |
| Formula | C21H20O6 |
| InchiKey | AZPLXDBZIQMMMT-UHFFFAOYSA-N |
| SMILES | COc1cc2occ(c(=O)c2c(c1CC=C(C)C)O)c1ccc(cc1O)O |
| Inchi | InChI=1S/C21H20O6/c1-11(2)4-6-14-17(26-3)9-18-19(20(14)24)21(25)15(10-27-18)13-7-5-12(22)8-16(13)23/h4-5,7-10,22-24H,6H2,1-3H3 |
| IUPAC | 3-(2,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-(3-methylbut-2-enyl)chromen-4-one |
| Molecular Weight | 368.13 |
| Pubchem Id | 441251 |
| Chembl Id | CHEMBL3809337 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50172097 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3809337 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
