Showing entry for cinnamacrin-B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0034786 |
| Compound Name | cinnamacrin-B |
| Structure | ![]() |
| Formula | C15H18O4 |
| InchiKey | JYCLPWSCXLTHKA-LSDHHAIUSA-N |
| SMILES | OC(=O)C1=C(C)[C@@]2(C3=C(C1=O)OC[C@]3(C)CCC2)C |
| Inchi | InChI=1S/C15H18O4/c1-8-9(13(17)18)10(16)11-12-14(2,7-19-11)5-4-6-15(8,12)3/h4-7H2,1-3H3,(H,17,18)/t14-,15+/m0/s1 |
| IUPAC | |
| Molecular Weight | 262.12 |
| Pubchem Id | 16109833 |
| Chembl Id | CHEMBL221384 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL221384 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
