Showing entry for leptospermone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0035078 |
| Compound Name | leptospermone |
| Structure | ![]() |
| Formula | C15H22O4 |
| InchiKey | YDWYMAHAWHBPPT-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)C1C(=O)C(C)(C)C(=O)C(C1=O)(C)C)C |
| Inchi | InChI=1S/C15H22O4/c1-8(2)7-9(16)10-11(17)14(3,4)13(19)15(5,6)12(10)18/h8,10H,7H2,1-6H3 |
| IUPAC | 2,2,4,4-tetramethyl-6-(3-methylbutanoyl)cyclohexane-1,3,5-trione |
| Molecular Weight | 266.15 |
| Pubchem Id | 3083632 |
| Chembl Id | CHEMBL4090482 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4090482 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
