Showing entry for Cynarascoloside A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0035138 |
| Compound Name | Cynarascoloside A |
| Structure | ![]() |
| Formula | C21H32O9 |
| InchiKey | BOYYQYRAKVYWCI-JSBOQLKZSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2CC(=C)[C@H]3[C@@H]([C@@H]4[C@@H]2[C@H](C)C(=O)O4)[C@@H]([C@@H](C3)O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C21H32O9/c1-7-4-12(28-21-18(26)17(25)16(24)13(6-22)29-21)15-9(3)20(27)30-19(15)14-8(2)11(23)5-10(7)14/h8-19,21-26H,1,4-6H2,2-3H3/t8-,9+,10+,11-,12+,13-,14+,15-,16-,17+,18-,19-,21-/m1/s1 |
| IUPAC | (3S,3aR,4S,6aR,8R,9S,9aR,9bR)-8-hydroxy-3,9-dimethyl-6-methylidene-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,3a,4,5,6a,7,8,9,9a,9b-decahydroazuleno[4,5-b]furan-2-one |
| Molecular Weight | 428.2 |
| Pubchem Id | 44144276 |
| Chembl Id | CHEMBL1882861 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1882861 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
