Showing entry for Des-O-methyllasiodiplodin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0035181 |
| Compound Name | Des-O-methyllasiodiplodin |
| Structure | ![]() |
| Formula | C15H20O4 |
| InchiKey | CSPXAUIPCGDIQH-UHFFFAOYSA-N |
| SMILES | Oc1cc2CCCCCCCCOC(=O)c2c(c1)O |
| Inchi | InChI=1S/C15H20O4/c16-12-9-11-7-5-3-1-2-4-6-8-19-15(18)14(11)13(17)10-12/h9-10,16-17H,1-8H2 |
| IUPAC | 13,15-dihydroxy-10-oxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-11-one |
| Molecular Weight | 264.14 |
| Pubchem Id | 5316596 |
| Chembl Id | CHEMBL1669771 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1669771 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
