Showing entry for Acutumine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0035318 |
| Compound Name | Acutumine |
| Structure | ![]() |
| Formula | C19H24ClNO6 |
| InchiKey | FSXRARBVZZKCGJ-UROMYXJWSA-N |
| SMILES | COC1=CC(=O)[C@@]2([C@@H]1O)[C@@H](Cl)C[C@]13[C@]2(CCN1C)CC(=O)C(=C3OC)OC |
| Inchi | InChI=1S/C19H24ClNO6/c1-21-6-5-17-8-10(22)14(26-3)16(27-4)18(17,21)9-12(20)19(17)13(23)7-11(25-2)15(19)24/h7,12,15,24H,5-6,8-9H2,1-4H3/t12-,15+,17-,18-,19+/m0/s1 |
| IUPAC | |
| Molecular Weight | 397.13 |
| Pubchem Id | 44144274 |
| Chembl Id | CHEMBL1716763 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1716763 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
