Showing entry for Picrasidine M
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0035386 |
| Compound Name | Picrasidine M |
| Structure | ![]() |
| Formula | C29H22N4O4 |
| InchiKey | RXCDWRJHTVZARX-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1[nH]c1c2c(OC)cnc1CCn1ccc2c3c1cc(=O)c(=O)n3c1c2cccc1 |
| Inchi | InChI=1S/C29H22N4O4/c1-36-23-9-5-7-18-25-24(37-2)15-30-19(27(25)31-26(18)23)11-13-32-12-10-17-16-6-3-4-8-20(16)33-28(17)21(32)14-22(34)29(33)35/h3-10,12,14-15,31H,11,13H2,1-2H3 |
| IUPAC | |
| Molecular Weight | 490.16 |
| Pubchem Id | 5320555 |
| Chembl Id | CHEMBL3401863 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3401863 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
