Showing entry for Monovaccenin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0035584 |
| Compound Name | Monovaccenin |
| Structure | ![]() |
| Formula | C5H10O4 |
| InchiKey | KMZHZAAOEWVPSE-RXMQYKEDSA-N |
| SMILES | CC(=O)OC[C@@H](CO)O |
| Inchi | InChI=1S/C5H10O4/c1-4(7)9-3-5(8)2-6/h5-6,8H,2-3H2,1H3/t5-/m1/s1 |
| IUPAC | [(2R)-2,3-dihydroxypropyl] acetate |
| Molecular Weight | 134.06 |
| Pubchem Id | 6999061 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | JIM |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
