Showing entry for 12alpha-Acetoxy-13beta,18beta-cyclobutane-20,24-dimethyl-24-oxoscalar-16-en-25beta-ol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0035851 |
| Compound Name | 12alpha-Acetoxy-13beta,18beta-cyclobutane-20,24-dimethyl-24-oxoscalar-16-en-25beta-ol |
| Structure | ![]() |
| Formula | C29H44O4 |
| InchiKey | CAMNRSFPFNRTLQ-JYDWNUQHSA-N |
| SMILES | CC[C@@]1(C)CCC[C@]2([C@H]1CC[C@@]1([C@@H]2C[C@@H]([C@]23[C@H]1CC=C([C@@H]3[C@@H](C2)O)C(=O)C)OC(=O)C)C)C |
| Inchi | InChI=1S/C29H44O4/c1-7-26(4)12-8-13-27(5)21(26)11-14-28(6)22-10-9-19(17(2)30)25-20(32)16-29(22,25)24(15-23(27)28)33-18(3)31/h9,20-25,32H,7-8,10-16H2,1-6H3/t20-,21+,22+,23-,24+,25-,26+,27+,28+,29-/m1/s1 |
| IUPAC | |
| Molecular Weight | 456.32 |
| Pubchem Id | 16680049 |
| Chembl Id | CHEMBL228073 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL228073 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
