Showing entry for Tectorigenin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0035956 |
| Compound Name | Tectorigenin |
| Structure | ![]() |
| Formula | C16H12O6 |
| InchiKey | OBBCRPUNCUPUOS-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc2c(c1O)c(=O)c(co2)c1ccc(cc1)O |
| Inchi | InChI=1S/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 |
| IUPAC | 5,7-dihydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one |
| Molecular Weight | 300.06 |
| Pubchem Id | 5281811 |
| Chembl Id | CHEMBL242740 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50241222 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL242740 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
