Showing entry for Licoflavone A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0036160 |
| Compound Name | Licoflavone A |
| Structure | ![]() |
| Formula | C20H18O4 |
| InchiKey | HJGURBGBPIKRER-UHFFFAOYSA-N |
| SMILES | CC(=CCc1cc2c(=O)cc(oc2cc1O)c1ccc(cc1)O)C |
| Inchi | InChI=1S/C20H18O4/c1-12(2)3-4-14-9-16-18(23)11-19(24-20(16)10-17(14)22)13-5-7-15(21)8-6-13/h3,5-11,21-22H,4H2,1-2H3 |
| IUPAC | 7-hydroxy-2-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one |
| Molecular Weight | 322.12 |
| Pubchem Id | 5319000 |
| Chembl Id | CHEMBL506929 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50325942 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL506929 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
