Showing entry for 5-(1,1-Dimethylallyl)-3,4,4'-trihydroxy-2-methoxychalcone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0036378 |
| Compound Name | 5-(1,1-Dimethylallyl)-3,4,4'-trihydroxy-2-methoxychalcone |
| Structure | ![]() |
| Formula | C21H22O5 |
| InchiKey | WECAUVIWKBEGRA-DHZHZOJOSA-N |
| SMILES | C=CC(c1cc(/C=C/C(=O)c2ccc(cc2)O)c(c(c1O)O)OC)(C)C |
| Inchi | InChI=1S/C21H22O5/c1-5-21(2,3)16-12-14(20(26-4)19(25)18(16)24)8-11-17(23)13-6-9-15(22)10-7-13/h5-12,22,24-25H,1H2,2-4H3/b11-8+ |
| IUPAC | (E)-3-[3,4-dihydroxy-2-methoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| Molecular Weight | 354.15 |
| Pubchem Id | 38360783 |
| Chembl Id | CHEMBL4076010 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4076010 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
