Showing entry for 5-[2-(4-Hydroxyphenyl)Ethenyl]Benzene-1,3-Diol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0036732 |
| Compound Name | 5-[2-(4-Hydroxyphenyl)Ethenyl]Benzene-1,3-Diol |
| Structure | ![]() |
| Formula | C14H12O3 |
| InchiKey | LUKBXSAWLPMMSZ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C=Cc1cc(O)cc(c1)O |
| Inchi | InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H |
| IUPAC | 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| Molecular Weight | 228.08 |
| Pubchem Id | 5056 |
| Chembl Id | CHEMBL2019155 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2019155 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
