Showing entry for Demethyleucomin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0036733 |
| Compound Name | Demethyleucomin |
| Structure | ![]() |
| Formula | C16H12O5 |
| InchiKey | PKCWSPYCHMNVKB-BJMVGYQFSA-N |
| SMILES | Oc1ccc(cc1)/C=C/1\COc2c(C1=O)c(O)cc(c2)O |
| Inchi | InChI=1S/C16H12O5/c17-11-3-1-9(2-4-11)5-10-8-21-14-7-12(18)6-13(19)15(14)16(10)20/h1-7,17-19H,8H2/b10-5+ |
| IUPAC | (3E)-5,7-dihydroxy-3-[(4-hydroxyphenyl)methylidene]chromen-4-one |
| Molecular Weight | 284.07 |
| Pubchem Id | 15484393 |
| Chembl Id | CHEMBL1077616 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50341670 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1077616 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
