Showing entry for Gomisin J
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0036866 |
| Compound Name | Gomisin J |
| Structure | ![]() |
| Formula | C22H28O6 |
| InchiKey | PICOUNAPKDEPCA-TXEJJXNPSA-N |
| SMILES | COc1c2c(C[C@H](C)[C@@H](Cc3c2c(OC)c(c(c3)O)OC)C)cc(c1OC)O |
| Inchi | InChI=1S/C22H28O6/c1-11-7-13-9-15(23)19(25-3)21(27-5)17(13)18-14(8-12(11)2)10-16(24)20(26-4)22(18)28-6/h9-12,23-24H,7-8H2,1-6H3/t11-,12+ |
| IUPAC | |
| Molecular Weight | 388.19 |
| Pubchem Id | 3001686 |
| Chembl Id | CHEMBL251864 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL251864 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
