Showing entry for Pseudotropine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037010 |
| Compound Name | Pseudotropine |
| Structure | ![]() |
| Formula | C8H15NO |
| InchiKey | CYHOMWAPJJPNMW-RNLVFQAGSA-N |
| SMILES | O[C@@H]1C[C@H]2CC[C@@H](C1)N2C |
| Inchi | InChI=1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8- |
| IUPAC | |
| Molecular Weight | 141.12 |
| Pubchem Id | |
| Chembl Id | CHEMBL1235490 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | PTO |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1235490 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
