Showing entry for 3-methoxycanthin-2,6-dione
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037024 |
| Compound Name | 3-methoxycanthin-2,6-dione |
| Structure | ![]() |
| Formula | C15H10N2O3 |
| InchiKey | MGZZRRUKOPHKBA-UHFFFAOYSA-N |
| SMILES | COn1c(=O)cc2c3c1ccc(=O)n3c1c2cccc1 |
| Inchi | InChI=1S/C15H10N2O3/c1-20-17-12-6-7-13(18)16-11-5-3-2-4-9(11)10(15(12)16)8-14(17)19/h2-8H,1H3 |
| IUPAC | |
| Molecular Weight | 266.07 |
| Pubchem Id | 156537 |
| Chembl Id | CHEMBL454831 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL454831 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
