Showing entry for methyl syringate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037096 |
| Compound Name | methyl syringate |
| Structure | ![]() |
| Formula | C10H12O5 |
| InchiKey | ZMXJAEGJWHJMGX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c(c(c1)OC)O |
| Inchi | InChI=1S/C10H12O5/c1-13-7-4-6(10(12)15-3)5-8(14-2)9(7)11/h4-5,11H,1-3H3 |
| IUPAC | methyl 4-hydroxy-3,5-dimethoxybenzoate |
| Molecular Weight | 212.07 |
| Pubchem Id | 70164 |
| Chembl Id | CHEMBL1236122 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | DB08589 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | SYR |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1236122 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
