Showing entry for Artorigidin A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037188 |
| Compound Name | Artorigidin A |
| Structure | ![]() |
| Formula | C30H32O7 |
| InchiKey | LAAYVNVIRVOBNR-GOSISDBHSA-N |
| SMILES | CC(=CCc1c(O)c(CC=C(C)C)c(c2c1oc1c3c(O)cc(c(c3[C@H](Cc1c2=O)C(=C)C)O)O)O)C |
| Inchi | InChI=1S/C30H32O7/c1-13(2)7-9-16-25(33)17(10-8-14(3)4)29-24(26(16)34)27(35)19-11-18(15(5)6)22-23(30(19)37-29)20(31)12-21(32)28(22)36/h7-8,12,18,31-34,36H,5,9-11H2,1-4,6H3/t18-/m1/s1 |
| IUPAC | (5R)-1,3,4,8,10-pentahydroxy-9,11-bis(3-methylbut-2-enyl)-5-prop-1-en-2-yl-5,6-dihydrobenzo[c]xanthen-7-one |
| Molecular Weight | 504.21 |
| Pubchem Id | 46834285 |
| Chembl Id | CHEMBL1094756 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50317857 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1094756 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
