Showing entry for Caryophyllenepoxid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037198 |
| Compound Name | Caryophyllenepoxid |
| Structure | ![]() |
| Formula | C15H24O |
| InchiKey | NVEQFIOZRFFVFW-ABHRYQDASA-N |
| SMILES | C=C1CC[C@@H]2O[C@]2(CC[C@H]2[C@H]1CC2(C)C)C |
| Inchi | InChI=1S/C15H24O/c1-10-5-6-13-15(4,16-13)8-7-12-11(10)9-14(12,2)3/h11-13H,1,5-9H2,2-4H3/t11-,12-,13-,15-/m0/s1 |
| IUPAC | |
| Molecular Weight | 220.18 |
| Pubchem Id | 11908458 |
| Chembl Id | CHEMBL1553274 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1553274 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
