Showing entry for cycloartobiloxanthone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037337 |
| Compound Name | cycloartobiloxanthone |
| Structure | ![]() |
| Formula | C25H22O7 |
| InchiKey | OCZFLOUWXXGBPC-LBPRGKRZSA-N |
| SMILES | Oc1cc(O)c2c3c1c1oc4c5C=CC(Oc5cc(c4c(=O)c1C[C@@H]3C(O2)(C)C)O)(C)C |
| Inchi | InChI=1S/C25H22O7/c1-24(2)6-5-10-16(31-24)9-14(27)19-20(29)11-7-12-17-18(22(11)30-21(10)19)13(26)8-15(28)23(17)32-25(12,3)4/h5-6,8-9,12,26-28H,7H2,1-4H3/t12-/m0/s1 |
| IUPAC | |
| Molecular Weight | 434.14 |
| Pubchem Id | 46887867 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50317858 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
