Showing entry for Isoginsenoside Rh3
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037511 |
| Compound Name | Isoginsenoside Rh3 |
| Structure | ![]() |
| Formula | C36H60O7 |
| InchiKey | PHLXREOMFNVWOH-DNQFHFKUSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3/C(=C/CC=C(C)C)/C)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C36H60O7/c1-20(2)10-9-11-21(3)22-12-16-36(8)28(22)23(38)18-26-34(6)15-14-27(33(4,5)25(34)13-17-35(26,36)7)43-32-31(41)30(40)29(39)24(19-37)42-32/h10-11,22-32,37-41H,9,12-19H2,1-8H3/b21-11+/t22-,23-,24-,25+,26-,27+,28+,29-,30+,31-,32+,34+,35-,36-/ |
| IUPAC | |
| Molecular Weight | 604.43 |
| Pubchem Id | 122196267 |
| Chembl Id | CHEMBL3634639 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3634639 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
