Showing entry for 7,8-dimethylalloxazine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037731 |
| Compound Name | 7,8-dimethylalloxazine |
| Structure | ![]() |
| Formula | C12H10N4O2 |
| InchiKey | ZJTJUVIJVLLGSP-UHFFFAOYSA-N |
| SMILES | Oc1nc2nc3cc(C)c(cc3nc2c(n1)O)C |
| Inchi | InChI=1S/C12H10N4O2/c1-5-3-7-8(4-6(5)2)14-10-9(13-7)11(17)16-12(18)15-10/h3-4H,1-2H3,(H2,14,15,16,17,18) |
| IUPAC | 7,8-dimethyl-1H-benzo[g]pteridine-2,4-dione |
| Molecular Weight | 242.08 |
| Pubchem Id | 5326566 |
| Chembl Id | CHEMBL1234101 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | DB04345 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | LUM |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1234101 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
