Showing entry for Dehydroascorbic Acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037783 |
| Compound Name | Dehydroascorbic Acid |
| Structure | ![]() |
| Formula | C6H6O6 |
| InchiKey | SBJKKFFYIZUCET-JLAZNSOCSA-N |
| SMILES | OC[C@@H]([C@H]1OC(=O)C(=O)C1=O)O |
| Inchi | InChI=1S/C6H6O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-8H,1H2/t2-,5+/m0/s1 |
| IUPAC | (5R)-5-[(1S)-1,2-dihydroxyethyl]oxolane-2,3,4-trione |
| Molecular Weight | 174.02 |
| Pubchem Id | 440667 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | UU3 |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
