Showing entry for Vasicine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037836 |
| Compound Name | Vasicine |
| Structure | ![]() |
| Formula | C11H12N2O |
| InchiKey | YIICVSCAKJMMDJ-JTQLQIEISA-N |
| SMILES | O[C@H]1CCN2C1=Nc1ccccc1C2 |
| Inchi | InChI=1S/C11H12N2O/c14-10-5-6-13-7-8-3-1-2-4-9(8)12-11(10)13/h1-4,10,14H,5-7H2/t10-/m0/s1 |
| IUPAC | (3S)-1,2,3,9-tetrahydropyrrolo[2,1-b]quinazolin-3-ol |
| Molecular Weight | 188.09 |
| Pubchem Id | 667496 |
| Chembl Id | CHEMBL2163791 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50396012 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2163791 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
